C28H37FN2O6 — CID 69193257
tert-butyl N-[(2R,3R,6S)-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-6-[2-(3-fluoro-6-methoxyquinolin-4-yl)ethenyl]oxan-3-yl]carbamate (PubChem CID 69193257) has the molecular formula C28H37FN2O6 and a molecular weight of 516.61 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R,6S)-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-6-[2-(3-fluoro-6-methoxyquinolin-4-yl)ethenyl]oxan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3R,6S)-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-6-[2-(3-fluoro-6-methoxyquinolin-4-yl)ethenyl]oxan-3-yl]carbamate |
|---|---|
| PubChem CID | 69193257 |
| Molecular Formula | C28H37FN2O6 |
| Molecular Weight | 516.61 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | tert-butyl N-[(2R,3R,6S)-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-6-[2-(3-fluoro-6-methoxyquinolin-4-yl)ethenyl]oxan-3-yl]carbamate |
| SMILES | COc1ccc2ncc(F)c(C=C[C@@H]3CC[C@@H](NC(=O)OC(C)(C)C)[C@@H](CC4COC(C)(C)O4)O3)c2c1 |
| InChI | InChI=1S/C28H37FN2O6/c1-27(2,3)37-26(32)31-24-12-8-17(35-25(24)14-19-16-34-28(4,5)36-19)7-10-20-21-13-18(33-6)9-11-23(21)30-15-22(20)29/h7,9-11,13,15,17,19,24-25H,8,12,14,16H2,1-6H3,(H,31,32)/t17-,19?,24-,25-/m1/s1 |
| InChIKey | YWOSZYZJFQWPQQ-IPMBONDKSA-N |
| XLogP | 5.38 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.61 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |