C27H36FN3O6 — CID 69193963
tert-butyl N-[(2S,3R,6S)-2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethenyl]oxan-3-yl]carbamate (PubChem CID 69193963) has the molecular formula C27H36FN3O6 and a molecular weight of 517.60 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R,6S)-2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethenyl]oxan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R,6S)-2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethenyl]oxan-3-yl]carbamate |
|---|---|
| PubChem CID | 69193963 |
| Molecular Formula | C27H36FN3O6 |
| Molecular Weight | 517.60 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | tert-butyl N-[(2S,3R,6S)-2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-6-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethenyl]oxan-3-yl]carbamate |
| SMILES | COc1ccc2ncc(F)c(C=C[C@@H]3CC[C@@H](NC(=O)OC(C)(C)C)[C@H](C[C@@H]4COC(C)(C)O4)O3)c2n1 |
| InChI | InChI=1S/C27H36FN3O6/c1-26(2,3)37-25(32)30-20-10-8-16(35-22(20)13-17-15-34-27(4,5)36-17)7-9-18-19(28)14-29-21-11-12-23(33-6)31-24(18)21/h7,9,11-12,14,16-17,20,22H,8,10,13,15H2,1-6H3,(H,30,32)/t16-,17-,20-,22+/m1/s1 |
| InChIKey | NPTDFDJPCULCFM-PCBBRVBVSA-N |
| XLogP | 4.77 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.60 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |