C27H27F2N3O4 — CID 24784659
2-[(2R,3R,6S)-3-[[(E)-3-(2,5-difluorophenyl)prop-2-enyl]amino]-6-[(E)-2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]oxan-2-yl]acetic acid (PubChem CID 24784659) has the molecular formula C27H27F2N3O4 and a molecular weight of 495.53 g/mol. Its IUPAC name is 2-[(2R,3R,6S)-3-[[(E)-3-(2,5-difluorophenyl)prop-2-enyl]amino]-6-[(E)-2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]oxan-2-yl]acetic acid.
| Compound Name | 2-[(2R,3R,6S)-3-[[(E)-3-(2,5-difluorophenyl)prop-2-enyl]amino]-6-[(E)-2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]oxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 24784659 |
| Molecular Formula | C27H27F2N3O4 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 2-[(2R,3R,6S)-3-[[(E)-3-(2,5-difluorophenyl)prop-2-enyl]amino]-6-[(E)-2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]oxan-2-yl]acetic acid |
| SMILES | COc1ccc2nccc(/C=C/[C@@H]3CC[C@@H](NC/C=C/c4cc(F)ccc4F)[C@@H](CC(=O)O)O3)c2n1 |
| InChI | InChI=1S/C27H27F2N3O4/c1-35-25-11-10-23-27(32-25)17(12-14-31-23)4-6-20-7-9-22(24(36-20)16-26(33)34)30-13-2-3-18-15-19(28)5-8-21(18)29/h2-6,8,10-12,14-15,20,22,24,30H,7,9,13,16H2,1H3,(H,33,34)/b3-2+,6-4+/t20-,22-,24-/m1/s1 |
| InChIKey | RALGROWYDGXNIK-GFBCROQTSA-N |
| XLogP | 4.62 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |