C28H31F2N3O4 — CID 67996261
(2S)-3-[(2R,3R,6S)-3-[[(E)-3-(2,5-difluorophenyl)prop-2-enyl]amino]-6-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]oxan-2-yl]propane-1,2-diol (PubChem CID 67996261) has the molecular formula C28H31F2N3O4 and a molecular weight of 511.57 g/mol. Its IUPAC name is (2S)-3-[(2R,3R,6S)-3-[[(E)-3-(2,5-difluorophenyl)prop-2-enyl]amino]-6-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]oxan-2-yl]propane-1,2-diol.
| Compound Name | (2S)-3-[(2R,3R,6S)-3-[[(E)-3-(2,5-difluorophenyl)prop-2-enyl]amino]-6-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]oxan-2-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 67996261 |
| Molecular Formula | C28H31F2N3O4 |
| Molecular Weight | 511.57 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | (2S)-3-[(2R,3R,6S)-3-[[(E)-3-(2,5-difluorophenyl)prop-2-enyl]amino]-6-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]oxan-2-yl]propane-1,2-diol |
| SMILES | COc1ccc2nccc(C=C[C@@H]3CC[C@@H](NC/C=C/c4cc(F)ccc4F)[C@@H](C[C@H](O)CO)O3)c2n1 |
| InChI | InChI=1S/C28H31F2N3O4/c1-36-27-11-10-25-28(33-27)18(12-14-32-25)4-6-22-7-9-24(26(37-22)16-21(35)17-34)31-13-2-3-19-15-20(29)5-8-23(19)30/h2-6,8,10-12,14-15,21-22,24,26,31,34-35H,7,9,13,16-17H2,1H3/b3-2+,6-4?/t21-,22+,24+,26+/m0/s1 |
| InChIKey | PLPJZLGVBJMEHV-ULGWUFRZSA-N |
| XLogP | 3.89 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.57 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |