C27H39N3O7 — CID 67996106
tert-butyl N-[(2R,3R,6S)-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-6-[(1S)-1-hydroxy-2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]oxan-3-yl]carbamate (PubChem CID 67996106) has the molecular formula C27H39N3O7 and a molecular weight of 517.62 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R,6S)-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-6-[(1S)-1-hydroxy-2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]oxan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3R,6S)-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-6-[(1S)-1-hydroxy-2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]oxan-3-yl]carbamate |
|---|---|
| PubChem CID | 67996106 |
| Molecular Formula | C27H39N3O7 |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 517.28 |
| IUPAC Name | tert-butyl N-[(2R,3R,6S)-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-6-[(1S)-1-hydroxy-2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]oxan-3-yl]carbamate |
| SMILES | COc1ccc2nccc(C[C@H](O)[C@@H]3CC[C@@H](NC(=O)OC(C)(C)C)[C@@H](CC4COC(C)(C)O4)O3)c2n1 |
| InChI | InChI=1S/C27H39N3O7/c1-26(2,3)37-25(32)29-18-7-9-21(35-22(18)14-17-15-34-27(4,5)36-17)20(31)13-16-11-12-28-19-8-10-23(33-6)30-24(16)19/h8,10-12,17-18,20-22,31H,7,9,13-15H2,1-6H3,(H,29,32)/t17?,18-,20+,21+,22-/m1/s1 |
| InChIKey | WIFPTCAZGUUVPP-CEJSSCJVSA-N |
| XLogP | 3.52 |
| TPSA | 121.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |