C28H31F2N3O5 — CID 67996415
(E)-3-(2,5-difluorophenyl)-N-[(2S,3R,6S)-2-[(2S)-2,3-dihydroxypropyl]-6-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]oxan-3-yl]prop-2-enamide (PubChem CID 67996415) has the molecular formula C28H31F2N3O5 and a molecular weight of 527.57 g/mol. Its IUPAC name is (E)-3-(2,5-difluorophenyl)-N-[(2S,3R,6S)-2-[(2S)-2,3-dihydroxypropyl]-6-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]oxan-3-yl]prop-2-enamide.
| Compound Name | (E)-3-(2,5-difluorophenyl)-N-[(2S,3R,6S)-2-[(2S)-2,3-dihydroxypropyl]-6-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]oxan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 67996415 |
| Molecular Formula | C28H31F2N3O5 |
| Molecular Weight | 527.57 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | (E)-3-(2,5-difluorophenyl)-N-[(2S,3R,6S)-2-[(2S)-2,3-dihydroxypropyl]-6-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]oxan-3-yl]prop-2-enamide |
| SMILES | COc1ccc2nccc(CC[C@H]3CC[C@@H](NC(=O)/C=C/c4cc(F)ccc4F)[C@H](C[C@H](O)CO)O3)c2n1 |
| InChI | InChI=1S/C28H31F2N3O5/c1-37-27-11-9-24-28(33-27)17(12-13-31-24)2-5-21-6-8-23(25(38-21)15-20(35)16-34)32-26(36)10-3-18-14-19(29)4-7-22(18)30/h3-4,7,9-14,20-21,23,25,34-35H,2,5-6,8,15-16H2,1H3,(H,32,36)/b10-3+/t20-,21-,23+,25-/m0/s1 |
| InChIKey | VEJQZJMFUXDVRM-OZRZBKRBSA-N |
| XLogP | 3.34 |
| TPSA | 113.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|