C28H31F3N2O3 — CID 67996907
(2S)-3-[(2R,3R,6R)-3-[3-(2,5-difluorophenyl)prop-2-enylamino]-6-[2-(6-fluoroquinolin-4-yl)ethyl]oxan-2-yl]propane-1,2-diol (PubChem CID 67996907) has the molecular formula C28H31F3N2O3 and a molecular weight of 500.56 g/mol. Its IUPAC name is (2S)-3-[(2R,3R,6R)-3-[3-(2,5-difluorophenyl)prop-2-enylamino]-6-[2-(6-fluoroquinolin-4-yl)ethyl]oxan-2-yl]propane-1,2-diol.
| Compound Name | (2S)-3-[(2R,3R,6R)-3-[3-(2,5-difluorophenyl)prop-2-enylamino]-6-[2-(6-fluoroquinolin-4-yl)ethyl]oxan-2-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 67996907 |
| Molecular Formula | C28H31F3N2O3 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | (2S)-3-[(2R,3R,6R)-3-[3-(2,5-difluorophenyl)prop-2-enylamino]-6-[2-(6-fluoroquinolin-4-yl)ethyl]oxan-2-yl]propane-1,2-diol |
| SMILES | OC[C@@H](O)C[C@H]1O[C@H](CCc2ccnc3ccc(F)cc23)CC[C@H]1NCC=Cc1cc(F)ccc1F |
| InChI | InChI=1S/C28H31F3N2O3/c29-20-4-8-25(31)19(14-20)2-1-12-32-27-10-7-23(36-28(27)16-22(35)17-34)6-3-18-11-13-33-26-9-5-21(30)15-24(18)26/h1-2,4-5,8-9,11,13-15,22-23,27-28,32,34-35H,3,6-7,10,12,16-17H2/t22-,23+,27+,28+/m0/s1 |
| InChIKey | QYPUHNLJGVSERQ-CCXYNAMNSA-N |
| XLogP | 4.55 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |