C29H32F2N2O5 — CID 67996121
(E)-3-(2,5-difluorophenyl)-N-[(2S,3R,6S)-2-[(2R)-2,3-dihydroxypropyl]-6-[2-(3-methoxyquinolin-5-yl)ethyl]oxan-3-yl]prop-2-enamide (PubChem CID 67996121) has the molecular formula C29H32F2N2O5 and a molecular weight of 526.58 g/mol. Its IUPAC name is (E)-3-(2,5-difluorophenyl)-N-[(2S,3R,6S)-2-[(2R)-2,3-dihydroxypropyl]-6-[2-(3-methoxyquinolin-5-yl)ethyl]oxan-3-yl]prop-2-enamide.
| Compound Name | (E)-3-(2,5-difluorophenyl)-N-[(2S,3R,6S)-2-[(2R)-2,3-dihydroxypropyl]-6-[2-(3-methoxyquinolin-5-yl)ethyl]oxan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 67996121 |
| Molecular Formula | C29H32F2N2O5 |
| Molecular Weight | 526.58 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | (E)-3-(2,5-difluorophenyl)-N-[(2S,3R,6S)-2-[(2R)-2,3-dihydroxypropyl]-6-[2-(3-methoxyquinolin-5-yl)ethyl]oxan-3-yl]prop-2-enamide |
| SMILES | COc1cnc2cccc(CC[C@H]3CC[C@@H](NC(=O)/C=C/c4cc(F)ccc4F)[C@H](C[C@@H](O)CO)O3)c2c1 |
| InChI | InChI=1S/C29H32F2N2O5/c1-37-23-15-24-18(3-2-4-26(24)32-16-23)5-8-22-9-11-27(28(38-22)14-21(35)17-34)33-29(36)12-6-19-13-20(30)7-10-25(19)31/h2-4,6-7,10,12-13,15-16,21-22,27-28,34-35H,5,8-9,11,14,17H2,1H3,(H,33,36)/b12-6+/t21-,22+,27-,28+/m1/s1 |
| InChIKey | LGAYIDFNDPOKAG-ANJDBMBDSA-N |
| XLogP | 3.94 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.58 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|