C28H30F2N2O6 — CID 67995610
(E)-3-(2,5-difluorophenyl)-N-[(2S,3R,6S)-2-[(2S)-2,3-dihydroxypropyl]-6-[(6-methoxyquinolin-4-yl)oxymethyl]oxan-3-yl]prop-2-enamide (PubChem CID 67995610) has the molecular formula C28H30F2N2O6 and a molecular weight of 528.55 g/mol. Its IUPAC name is (E)-3-(2,5-difluorophenyl)-N-[(2S,3R,6S)-2-[(2S)-2,3-dihydroxypropyl]-6-[(6-methoxyquinolin-4-yl)oxymethyl]oxan-3-yl]prop-2-enamide.
| Compound Name | (E)-3-(2,5-difluorophenyl)-N-[(2S,3R,6S)-2-[(2S)-2,3-dihydroxypropyl]-6-[(6-methoxyquinolin-4-yl)oxymethyl]oxan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 67995610 |
| Molecular Formula | C28H30F2N2O6 |
| Molecular Weight | 528.55 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | (E)-3-(2,5-difluorophenyl)-N-[(2S,3R,6S)-2-[(2S)-2,3-dihydroxypropyl]-6-[(6-methoxyquinolin-4-yl)oxymethyl]oxan-3-yl]prop-2-enamide |
| SMILES | COc1ccc2nccc(OC[C@@H]3CC[C@@H](NC(=O)/C=C/c4cc(F)ccc4F)[C@H](C[C@H](O)CO)O3)c2c1 |
| InChI | InChI=1S/C28H30F2N2O6/c1-36-20-4-7-24-22(14-20)26(10-11-31-24)37-16-21-5-8-25(27(38-21)13-19(34)15-33)32-28(35)9-2-17-12-18(29)3-6-23(17)30/h2-4,6-7,9-12,14,19,21,25,27,33-34H,5,8,13,15-16H2,1H3,(H,32,35)/b9-2+/t19-,21-,25+,27-/m0/s1 |
| InChIKey | OQMRMUAUTQUTOQ-DZEFFVETSA-N |
| XLogP | 3.39 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.55 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|