C16H20FN3O4 — CID 67131153
tert-butyl N-[(2R)-2-(6-fluoro-3-methoxyquinoxalin-5-yl)-2-hydroxyethyl]carbamate (PubChem CID 67131153) has the molecular formula C16H20FN3O4 and a molecular weight of 337.35 g/mol. Its IUPAC name is tert-butyl N-[(2R)-2-(6-fluoro-3-methoxyquinoxalin-5-yl)-2-hydroxyethyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-2-(6-fluoro-3-methoxyquinoxalin-5-yl)-2-hydroxyethyl]carbamate |
|---|---|
| PubChem CID | 67131153 |
| Molecular Formula | C16H20FN3O4 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | tert-butyl N-[(2R)-2-(6-fluoro-3-methoxyquinoxalin-5-yl)-2-hydroxyethyl]carbamate |
| SMILES | COc1cnc2ccc(F)c([C@@H](O)CNC(=O)OC(C)(C)C)c2n1 |
| InChI | InChI=1S/C16H20FN3O4/c1-16(2,3)24-15(22)19-7-11(21)13-9(17)5-6-10-14(13)20-12(23-4)8-18-10/h5-6,8,11,21H,7H2,1-4H3,(H,19,22)/t11-/m0/s1 |
| InChIKey | ZFFWUQWWQPSRMA-NSHDSACASA-N |
| XLogP | 2.34 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |