C13H17N3O3 — CID 21064725
tert-butyl N-[2-hydroxy-2-(5-isocyano-2-pyridinyl)ethyl]carbamate (PubChem CID 21064725) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is tert-butyl N-[2-hydroxy-2-(5-isocyano-2-pyridinyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-hydroxy-2-(5-isocyano-2-pyridinyl)ethyl]carbamate |
|---|---|
| PubChem CID | 21064725 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | tert-butyl N-[2-hydroxy-2-(5-isocyano-2-pyridinyl)ethyl]carbamate |
| SMILES | [C-]#[N+]c1ccc(C(O)CNC(=O)OC(C)(C)C)nc1 |
| InChI | InChI=1S/C13H17N3O3/c1-13(2,3)19-12(18)16-8-11(17)10-6-5-9(14-4)7-15-10/h5-7,11,17H,8H2,1-3H3,(H,16,18) |
| InChIKey | YOTOIYSHBSFFCE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 75.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|