C22H32FN4O4+ — CID 69279597
[1-tert-butyl-1-[2-(6-fluoro-3-methoxyquinoxalin-5-yl)-3-hydroxypropyl]piperidin-1-ium-4-yl]carbamic acid (PubChem CID 69279597) has the molecular formula C22H32FN4O4+ and a molecular weight of 435.52 g/mol. Its IUPAC name is [1-tert-butyl-1-[2-(6-fluoro-3-methoxyquinoxalin-5-yl)-3-hydroxypropyl]piperidin-1-ium-4-yl]carbamic acid.
| Compound Name | [1-tert-butyl-1-[2-(6-fluoro-3-methoxyquinoxalin-5-yl)-3-hydroxypropyl]piperidin-1-ium-4-yl]carbamic acid |
|---|---|
| PubChem CID | 69279597 |
| Molecular Formula | C22H32FN4O4+ |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | [1-tert-butyl-1-[2-(6-fluoro-3-methoxyquinoxalin-5-yl)-3-hydroxypropyl]piperidin-1-ium-4-yl]carbamic acid |
| SMILES | COc1cnc2ccc(F)c(C(CO)C[N+]3(C(C)(C)C)CCC(NC(=O)O)CC3)c2n1 |
| InChI | InChI=1S/C22H31FN4O4/c1-22(2,3)27(9-7-15(8-10-27)25-21(29)30)12-14(13-28)19-16(23)5-6-17-20(19)26-18(31-4)11-24-17/h5-6,11,14-15,25,28H,7-10,12-13H2,1-4H3/p+1 |
| InChIKey | PULCAMSECZARGW-UHFFFAOYSA-O |
| XLogP | 2.90 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|