C21H27F2N4O4+ — CID 68742427
[1-tert-butyl-1-[(5,10-difluoro-3-hydroxy-11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl)methyl]piperidin-1-ium-4-yl]carbamic acid (PubChem CID 68742427) has the molecular formula C21H27F2N4O4+ and a molecular weight of 437.47 g/mol. Its IUPAC name is [1-tert-butyl-1-[(5,10-difluoro-3-hydroxy-11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl)methyl]piperidin-1-ium-4-yl]carbamic acid.
| Compound Name | [1-tert-butyl-1-[(5,10-difluoro-3-hydroxy-11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl)methyl]piperidin-1-ium-4-yl]carbamic acid |
|---|---|
| PubChem CID | 68742427 |
| Molecular Formula | C21H27F2N4O4+ |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | [1-tert-butyl-1-[(5,10-difluoro-3-hydroxy-11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl)methyl]piperidin-1-ium-4-yl]carbamic acid |
| SMILES | CC(C)(C)[N+]1(CC2(O)Cn3c(=O)c(F)cc4ncc(F)c2c43)CCC(NC(=O)O)CC1 |
| InChI | InChI=1S/C21H26F2N4O4/c1-20(2,3)27(6-4-12(5-7-27)25-19(29)30)11-21(31)10-26-17-15(8-13(22)18(26)28)24-9-14(23)16(17)21/h8-9,12,25,31H,4-7,10-11H2,1-3H3/p+1 |
| InChIKey | CXDRNYZIERCPEW-UHFFFAOYSA-O |
| XLogP | 1.92 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|