C21H27FN4O4 — CID 86628366
tert-butyl N-[1-[(5-fluoro-3-hydroxy-11-oxo-1,9-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-3-yl)methyl]piperidin-4-yl]carbamate (PubChem CID 86628366) has the molecular formula C21H27FN4O4 and a molecular weight of 418.47 g/mol. Its IUPAC name is tert-butyl N-[1-[(5-fluoro-3-hydroxy-11-oxo-1,9-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-3-yl)methyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(5-fluoro-3-hydroxy-11-oxo-1,9-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-3-yl)methyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 86628366 |
| Molecular Formula | C21H27FN4O4 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | tert-butyl N-[1-[(5-fluoro-3-hydroxy-11-oxo-1,9-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-3-yl)methyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(CC2(O)Cn3c(=O)cnc4ccc(F)c2c43)CC1 |
| InChI | InChI=1S/C21H27FN4O4/c1-20(2,3)30-19(28)24-13-6-8-25(9-7-13)11-21(29)12-26-16(27)10-23-15-5-4-14(22)17(21)18(15)26/h4-5,10,13,29H,6-9,11-12H2,1-3H3,(H,24,28) |
| InChIKey | AGNFGWQXGCRKPU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |