C21H29N5O4 — CID 86649709
tert-butyl N-[1-[(2,8-dioxo-1,4,9-triazatricyclo[7.3.1.05,13]trideca-3,5(13),6-trien-10-yl)methyl]piperidin-4-yl]carbamate (PubChem CID 86649709) has the molecular formula C21H29N5O4 and a molecular weight of 415.49 g/mol. Its IUPAC name is tert-butyl N-[1-[(2,8-dioxo-1,4,9-triazatricyclo[7.3.1.05,13]trideca-3,5(13),6-trien-10-yl)methyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(2,8-dioxo-1,4,9-triazatricyclo[7.3.1.05,13]trideca-3,5(13),6-trien-10-yl)methyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 86649709 |
| Molecular Formula | C21H29N5O4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | tert-butyl N-[1-[(2,8-dioxo-1,4,9-triazatricyclo[7.3.1.05,13]trideca-3,5(13),6-trien-10-yl)methyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(CC2CCn3c(=O)cnc4ccc(=O)n2c43)CC1 |
| InChI | InChI=1S/C21H29N5O4/c1-21(2,3)30-20(29)23-14-6-9-24(10-7-14)13-15-8-11-25-18(28)12-22-16-4-5-17(27)26(15)19(16)25/h4-5,12,14-15H,6-11,13H2,1-3H3,(H,23,29) |
| InChIKey | NIOOANDHBSWTKM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |