C24H23F2N5O3 — CID 67043924
3-(2,5-difluorophenyl)-N-[1-[(5,11-dioxo-1,4,7-triazatricyclo[6.3.1.04,12]dodeca-6,8(12),9-trien-3-yl)methyl]piperidin-4-yl]prop-2-enamide (PubChem CID 67043924) has the molecular formula C24H23F2N5O3 and a molecular weight of 467.48 g/mol. Its IUPAC name is 3-(2,5-difluorophenyl)-N-[1-[(5,11-dioxo-1,4,7-triazatricyclo[6.3.1.04,12]dodeca-6,8(12),9-trien-3-yl)methyl]piperidin-4-yl]prop-2-enamide.
| Compound Name | 3-(2,5-difluorophenyl)-N-[1-[(5,11-dioxo-1,4,7-triazatricyclo[6.3.1.04,12]dodeca-6,8(12),9-trien-3-yl)methyl]piperidin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 67043924 |
| Molecular Formula | C24H23F2N5O3 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | 3-(2,5-difluorophenyl)-N-[1-[(5,11-dioxo-1,4,7-triazatricyclo[6.3.1.04,12]dodeca-6,8(12),9-trien-3-yl)methyl]piperidin-4-yl]prop-2-enamide |
| SMILES | O=C(C=Cc1cc(F)ccc1F)NC1CCN(CC2Cn3c(=O)ccc4ncc(=O)n2c43)CC1 |
| InChI | InChI=1S/C24H23F2N5O3/c25-16-2-3-19(26)15(11-16)1-5-21(32)28-17-7-9-29(10-8-17)13-18-14-30-22(33)6-4-20-24(30)31(18)23(34)12-27-20/h1-6,11-12,17-18H,7-10,13-14H2,(H,28,32) |
| InChIKey | BXJUDXHHSKQICQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|