C22H25ClN6O2 — CID 44515395
(2R)-2-[[4-[(5-chloro-6-methyl-3-pyridinyl)methylamino]piperidin-1-yl]methyl]-1,4,7-triazatricyclo[6.3.1.04,12]dodeca-6,8(12),9-triene-5,11-dione (PubChem CID 44515395) has the molecular formula C22H25ClN6O2 and a molecular weight of 440.94 g/mol. Its IUPAC name is (2R)-2-[[4-[(5-chloro-6-methyl-3-pyridinyl)methylamino]piperidin-1-yl]methyl]-1,4,7-triazatricyclo[6.3.1.04,12]dodeca-6,8(12),9-triene-5,11-dione.
| Compound Name | (2R)-2-[[4-[(5-chloro-6-methyl-3-pyridinyl)methylamino]piperidin-1-yl]methyl]-1,4,7-triazatricyclo[6.3.1.04,12]dodeca-6,8(12),9-triene-5,11-dione |
|---|---|
| PubChem CID | 44515395 |
| Molecular Formula | C22H25ClN6O2 |
| Molecular Weight | 440.94 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | (2R)-2-[[4-[(5-chloro-6-methyl-3-pyridinyl)methylamino]piperidin-1-yl]methyl]-1,4,7-triazatricyclo[6.3.1.04,12]dodeca-6,8(12),9-triene-5,11-dione |
| SMILES | Cc1ncc(CNC2CCN(C[C@@H]3Cn4c(=O)cnc5ccc(=O)n3c54)CC2)cc1Cl |
| InChI | InChI=1S/C22H25ClN6O2/c1-14-18(23)8-15(9-24-14)10-25-16-4-6-27(7-5-16)12-17-13-28-21(31)11-26-19-2-3-20(30)29(17)22(19)28/h2-3,8-9,11,16-17,25H,4-7,10,12-13H2,1H3/t17-/m1/s1 |
| InChIKey | XJJBPWTXURGHMM-QGZVFWFLSA-N |
| XLogP | 1.72 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.94 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |