C23H26ClN5O2 — CID 44513250
(2R)-2-[[4-[(6-chloro-5-methyl-3-pyridinyl)methylamino]piperidin-1-yl]methyl]-1,4-diazatricyclo[6.3.1.04,12]dodeca-6,8(12),9-triene-5,11-dione (PubChem CID 44513250) has the molecular formula C23H26ClN5O2 and a molecular weight of 439.95 g/mol. Its IUPAC name is (2R)-2-[[4-[(6-chloro-5-methyl-3-pyridinyl)methylamino]piperidin-1-yl]methyl]-1,4-diazatricyclo[6.3.1.04,12]dodeca-6,8(12),9-triene-5,11-dione.
| Compound Name | (2R)-2-[[4-[(6-chloro-5-methyl-3-pyridinyl)methylamino]piperidin-1-yl]methyl]-1,4-diazatricyclo[6.3.1.04,12]dodeca-6,8(12),9-triene-5,11-dione |
|---|---|
| PubChem CID | 44513250 |
| Molecular Formula | C23H26ClN5O2 |
| Molecular Weight | 439.95 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | (2R)-2-[[4-[(6-chloro-5-methyl-3-pyridinyl)methylamino]piperidin-1-yl]methyl]-1,4-diazatricyclo[6.3.1.04,12]dodeca-6,8(12),9-triene-5,11-dione |
| SMILES | Cc1cc(CNC2CCN(C[C@@H]3Cn4c(=O)ccc5ccc(=O)n3c54)CC2)cnc1Cl |
| InChI | InChI=1S/C23H26ClN5O2/c1-15-10-16(12-26-22(15)24)11-25-18-6-8-27(9-7-18)13-19-14-28-20(30)4-2-17-3-5-21(31)29(19)23(17)28/h2-5,10,12,18-19,25H,6-9,11,13-14H2,1H3/t19-/m1/s1 |
| InChIKey | YDFSVKQLKHJDIM-LJQANCHMSA-N |
| XLogP | 2.33 |
| TPSA | 72.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.95 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|