C23H23FN6O2 — CID 44515098
5-[[[1-[[(3R)-5,11-dioxo-1,4,7-triazatricyclo[6.3.1.04,12]dodeca-6,8(12),9-trien-3-yl]methyl]piperidin-4-yl]amino]methyl]-2-fluorobenzonitrile (PubChem CID 44515098) has the molecular formula C23H23FN6O2 and a molecular weight of 434.48 g/mol. Its IUPAC name is 5-[[[1-[[(3R)-5,11-dioxo-1,4,7-triazatricyclo[6.3.1.04,12]dodeca-6,8(12),9-trien-3-yl]methyl]piperidin-4-yl]amino]methyl]-2-fluorobenzonitrile.
| Compound Name | 5-[[[1-[[(3R)-5,11-dioxo-1,4,7-triazatricyclo[6.3.1.04,12]dodeca-6,8(12),9-trien-3-yl]methyl]piperidin-4-yl]amino]methyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 44515098 |
| Molecular Formula | C23H23FN6O2 |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 5-[[[1-[[(3R)-5,11-dioxo-1,4,7-triazatricyclo[6.3.1.04,12]dodeca-6,8(12),9-trien-3-yl]methyl]piperidin-4-yl]amino]methyl]-2-fluorobenzonitrile |
| SMILES | N#Cc1cc(CNC2CCN(C[C@@H]3Cn4c(=O)ccc5ncc(=O)n3c54)CC2)ccc1F |
| InChI | InChI=1S/C23H23FN6O2/c24-19-2-1-15(9-16(19)10-25)11-26-17-5-7-28(8-6-17)13-18-14-29-21(31)4-3-20-23(29)30(18)22(32)12-27-20/h1-4,9,12,17-18,26H,5-8,11,13-14H2/t18-/m1/s1 |
| InChIKey | LLIQPKXOWHSCNA-GOSISDBHSA-N |
| XLogP | 1.38 |
| TPSA | 95.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |