C24H26FN5O2 — CID 44515360
3-[[4-[[(Z)-3-(3-fluorophenyl)prop-2-enyl]amino]piperidin-1-yl]methyl]-1,4,7-triazatricyclo[6.3.1.04,12]dodeca-6,8(12),9-triene-5,11-dione (PubChem CID 44515360) has the molecular formula C24H26FN5O2 and a molecular weight of 435.50 g/mol. Its IUPAC name is 3-[[4-[[(Z)-3-(3-fluorophenyl)prop-2-enyl]amino]piperidin-1-yl]methyl]-1,4,7-triazatricyclo[6.3.1.04,12]dodeca-6,8(12),9-triene-5,11-dione.
| Compound Name | 3-[[4-[[(Z)-3-(3-fluorophenyl)prop-2-enyl]amino]piperidin-1-yl]methyl]-1,4,7-triazatricyclo[6.3.1.04,12]dodeca-6,8(12),9-triene-5,11-dione |
|---|---|
| PubChem CID | 44515360 |
| Molecular Formula | C24H26FN5O2 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | 3-[[4-[[(Z)-3-(3-fluorophenyl)prop-2-enyl]amino]piperidin-1-yl]methyl]-1,4,7-triazatricyclo[6.3.1.04,12]dodeca-6,8(12),9-triene-5,11-dione |
| SMILES | O=c1ccc2ncc(=O)n3c2n1CC3CN1CCC(NC/C=C\c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C24H26FN5O2/c25-18-5-1-3-17(13-18)4-2-10-26-19-8-11-28(12-9-19)15-20-16-29-22(31)7-6-21-24(29)30(20)23(32)14-27-21/h1-7,13-14,19-20,26H,8-12,15-16H2/b4-2- |
| InChIKey | HJYOMNBSSSRGPG-RQOWECAXSA-N |
| XLogP | 2.02 |
| TPSA | 72.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |