C21H28FN3O4 — CID 91339553
tert-butyl N-[4-[(6-fluoro-4-methyl-3-oxoquinoxalin-5-yl)oxymethyl]cyclohexyl]carbamate (PubChem CID 91339553) has the molecular formula C21H28FN3O4 and a molecular weight of 405.47 g/mol. Its IUPAC name is tert-butyl N-[4-[(6-fluoro-4-methyl-3-oxoquinoxalin-5-yl)oxymethyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[(6-fluoro-4-methyl-3-oxoquinoxalin-5-yl)oxymethyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 91339553 |
| Molecular Formula | C21H28FN3O4 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | tert-butyl N-[4-[(6-fluoro-4-methyl-3-oxoquinoxalin-5-yl)oxymethyl]cyclohexyl]carbamate |
| SMILES | Cn1c(=O)cnc2ccc(F)c(OCC3CCC(NC(=O)OC(C)(C)C)CC3)c21 |
| InChI | InChI=1S/C21H28FN3O4/c1-21(2,3)29-20(27)24-14-7-5-13(6-8-14)12-28-19-15(22)9-10-16-18(19)25(4)17(26)11-23-16/h9-11,13-14H,5-8,12H2,1-4H3,(H,24,27) |
| InChIKey | MQHCRERYFKCZLS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |