C15H15FN2O4 — CID 90362983
ethyl 2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)-3-oxobutanoate (PubChem CID 90362983) has the molecular formula C15H15FN2O4 and a molecular weight of 306.29 g/mol. Its IUPAC name is ethyl 2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)-3-oxobutanoate.
| Compound Name | ethyl 2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)-3-oxobutanoate |
|---|---|
| PubChem CID | 90362983 |
| Molecular Formula | C15H15FN2O4 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | ethyl 2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)-3-oxobutanoate |
| SMILES | CCOC(=O)C(C(C)=O)c1c(F)cnc2ccc(OC)nc12 |
| InChI | InChI=1S/C15H15FN2O4/c1-4-22-15(20)12(8(2)19)13-9(16)7-17-10-5-6-11(21-3)18-14(10)13/h5-7,12H,4H2,1-3H3 |
| InChIKey | WCGVYSZDAYLZKV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|