C17H15FN2O — CID 141180436
7-fluoro-2-methoxy-8-(2-phenylethyl)-1,5-naphthyridine (PubChem CID 141180436) has the molecular formula C17H15FN2O and a molecular weight of 282.32 g/mol. Its IUPAC name is 7-fluoro-2-methoxy-8-(2-phenylethyl)-1,5-naphthyridine.
| Compound Name | 7-fluoro-2-methoxy-8-(2-phenylethyl)-1,5-naphthyridine |
|---|---|
| PubChem CID | 141180436 |
| Molecular Formula | C17H15FN2O |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 7-fluoro-2-methoxy-8-(2-phenylethyl)-1,5-naphthyridine |
| SMILES | COc1ccc2ncc(F)c(CCc3ccccc3)c2n1 |
| InChI | InChI=1S/C17H15FN2O/c1-21-16-10-9-15-17(20-16)13(14(18)11-19-15)8-7-12-5-3-2-4-6-12/h2-6,9-11H,7-8H2,1H3 |
| InChIKey | YKVPCCZYQXYFDH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |