C24H27FN4O — CID 59011512
8-[2-[(3aR,6aS)-5-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethyl]-7-fluoro-2-methoxy-1,5-naphthyridine (PubChem CID 59011512) has the molecular formula C24H27FN4O and a molecular weight of 406.51 g/mol. Its IUPAC name is 8-[2-[(3aR,6aS)-5-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethyl]-7-fluoro-2-methoxy-1,5-naphthyridine.
| Compound Name | 8-[2-[(3aR,6aS)-5-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethyl]-7-fluoro-2-methoxy-1,5-naphthyridine |
|---|---|
| PubChem CID | 59011512 |
| Molecular Formula | C24H27FN4O |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 8-[2-[(3aR,6aS)-5-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethyl]-7-fluoro-2-methoxy-1,5-naphthyridine |
| SMILES | COc1ccc2ncc(F)c(CCN3C[C@@H]4CN(Cc5ccccc5)C[C@@H]4C3)c2n1 |
| InChI | InChI=1S/C24H27FN4O/c1-30-23-8-7-22-24(27-23)20(21(25)11-26-22)9-10-28-13-18-15-29(16-19(18)14-28)12-17-5-3-2-4-6-17/h2-8,11,18-19H,9-10,12-16H2,1H3/t18-,19+ |
| InChIKey | OVPBLOYZKQOAFL-KDURUIRLSA-N |
| XLogP | 3.38 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |