C16H17FN2O5 — CID 67131048
3-butan-2-yloxy-2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)-3-oxopropanoic acid (PubChem CID 67131048) has the molecular formula C16H17FN2O5 and a molecular weight of 336.32 g/mol. Its IUPAC name is 3-butan-2-yloxy-2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)-3-oxopropanoic acid.
| Compound Name | 3-butan-2-yloxy-2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 67131048 |
| Molecular Formula | C16H17FN2O5 |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 3-butan-2-yloxy-2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)-3-oxopropanoic acid |
| SMILES | CCC(C)OC(=O)C(C(=O)O)c1c(F)cnc2ccc(OC)nc12 |
| InChI | InChI=1S/C16H17FN2O5/c1-4-8(2)24-16(22)13(15(20)21)12-9(17)7-18-10-5-6-11(23-3)19-14(10)12/h5-8,13H,4H2,1-3H3,(H,20,21) |
| InChIKey | CQGYRTBNYMOKOG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|