C17H23N3O4 — CID 169088316
butyl N-[6-methoxy-4-(1-methoxyethyl)-1,5-naphthyridin-3-yl]carbamate (PubChem CID 169088316) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is butyl N-[6-methoxy-4-(1-methoxyethyl)-1,5-naphthyridin-3-yl]carbamate.
| Compound Name | butyl N-[6-methoxy-4-(1-methoxyethyl)-1,5-naphthyridin-3-yl]carbamate |
|---|---|
| PubChem CID | 169088316 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | butyl N-[6-methoxy-4-(1-methoxyethyl)-1,5-naphthyridin-3-yl]carbamate |
| SMILES | CCCCOC(=O)Nc1cnc2ccc(OC)nc2c1C(C)OC |
| InChI | InChI=1S/C17H23N3O4/c1-5-6-9-24-17(21)19-13-10-18-12-7-8-14(23-4)20-16(12)15(13)11(2)22-3/h7-8,10-11H,5-6,9H2,1-4H3,(H,19,21) |
| InChIKey | WWIFTNPJNRYUBT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|