C17H23N3O3 — CID 163260744
tert-butyl N-[4-(1-ethoxyethyl)-1,5-naphthyridin-3-yl]carbamate (PubChem CID 163260744) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is tert-butyl N-[4-(1-ethoxyethyl)-1,5-naphthyridin-3-yl]carbamate.
| Compound Name | tert-butyl N-[4-(1-ethoxyethyl)-1,5-naphthyridin-3-yl]carbamate |
|---|---|
| PubChem CID | 163260744 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | tert-butyl N-[4-(1-ethoxyethyl)-1,5-naphthyridin-3-yl]carbamate |
| SMILES | CCOC(C)c1c(NC(=O)OC(C)(C)C)cnc2cccnc12 |
| InChI | InChI=1S/C17H23N3O3/c1-6-22-11(2)14-13(20-16(21)23-17(3,4)5)10-19-12-8-7-9-18-15(12)14/h7-11H,6H2,1-5H3,(H,20,21) |
| InChIKey | CFIWBMANFNRHKR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |