C20H29N3O2 — CID 143637389
2-ethyl-N-(6-methoxy-1,5-naphthyridin-4-yl)nonanamide (PubChem CID 143637389) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 2-ethyl-N-(6-methoxy-1,5-naphthyridin-4-yl)nonanamide.
| Compound Name | 2-ethyl-N-(6-methoxy-1,5-naphthyridin-4-yl)nonanamide |
|---|---|
| PubChem CID | 143637389 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 2-ethyl-N-(6-methoxy-1,5-naphthyridin-4-yl)nonanamide |
| SMILES | CCCCCCCC(CC)C(=O)Nc1ccnc2ccc(OC)nc12 |
| InChI | InChI=1S/C20H29N3O2/c1-4-6-7-8-9-10-15(5-2)20(24)22-17-13-14-21-16-11-12-18(25-3)23-19(16)17/h11-15H,4-10H2,1-3H3,(H,21,22,24) |
| InChIKey | CKJHKZGDNDWPRJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|