C26H40N2O2 — CID 19027890
2-heptyl-N-(6-methoxyquinolin-5-yl)nonanamide (PubChem CID 19027890) has the molecular formula C26H40N2O2 and a molecular weight of 412.62 g/mol. Its IUPAC name is 2-heptyl-N-(6-methoxyquinolin-5-yl)nonanamide.
| Compound Name | 2-heptyl-N-(6-methoxyquinolin-5-yl)nonanamide |
|---|---|
| PubChem CID | 19027890 |
| Molecular Formula | C26H40N2O2 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.31 |
| IUPAC Name | 2-heptyl-N-(6-methoxyquinolin-5-yl)nonanamide |
| SMILES | CCCCCCCC(CCCCCCC)C(=O)Nc1c(OC)ccc2ncccc12 |
| InChI | InChI=1S/C26H40N2O2/c1-4-6-8-10-12-15-21(16-13-11-9-7-5-2)26(29)28-25-22-17-14-20-27-23(22)18-19-24(25)30-3/h14,17-21H,4-13,15-16H2,1-3H3,(H,28,29) |
| InChIKey | QQVCSRRNOFRNLP-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|