About 2-ethyl-N-methyltetradecanamide
2-ethyl-N-methyltetradecanamide (PubChem CID 161072731) has the molecular formula C17H35NO
and a molecular weight of 269.47 g/mol. Its IUPAC name is 2-ethyl-N-methyltetradecanamide.
Molecular Properties
| Compound Name | 2-ethyl-N-methyltetradecanamide |
| PubChem CID | 161072731 |
| Molecular Formula | C17H35NO |
| Molecular Weight | 269.47 g/mol |
| Exact Mass | 269.27 |
| IUPAC Name | 2-ethyl-N-methyltetradecanamide |
| SMILES | CCCCCCCCCCCCC(CC)C(=O)NC |
| InChI | InChI=1S/C17H35NO/c1-4-6-7-8-9-10-11-12-13-14-15-16(5-2)17(19)18-3/h16H,4-15H2,1-3H3,(H,18,19) |
| InChIKey | NVHRPLFQIICZIW-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 269.47 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-N-methyltetradecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N-methyltetradecanamide?
The IUPAC name of 2-ethyl-N-methyltetradecanamide (CID 161072731) is 2-ethyl-N-methyltetradecanamide.
What is the SMILES notation for 2-ethyl-N-methyltetradecanamide?
The canonical SMILES for 2-ethyl-N-methyltetradecanamide is CCCCCCCCCCCCC(CC)C(=O)NC.
What is the InChIKey of 2-ethyl-N-methyltetradecanamide?
The InChIKey is NVHRPLFQIICZIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35NO/c1-4-6-7-8-9-10-11-12-13-14-15-16(5-2)17(19)18-3/h16H,4-15H2,1-3H3,(H,18,19).
What are the key properties of 2-ethyl-N-methyltetradecanamide?
2-ethyl-N-methyltetradecanamide has a molecular weight of 269.47 g/mol, XLogP of 5.07, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N-methyltetradecanamide is sourced from PubChem (CID 161072731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).