2-ethyl-N-methylpentanamide;molecular hydrogen

C8H19NO — CID 142188922

IUPAC2-ethyl-N-methylpentanamide;molecular hydrogen
SMILESCCCC(CC)C(=O)NC.[H][H]
InChIInChI=1S/C8H17NO.H2/c1-4-6-7(5-2)8(10)9-3;/h7H,4-6H2,1-3H3,(H,9,10);1H
InChIKeyFHQIGLPEHAPPDU-UHFFFAOYSA-N
MW145.25 g/mol
LogP1.80
Rot. Bonds4

About 2-ethyl-N-methylpentanamide;molecular hydrogen

2-ethyl-N-methylpentanamide;molecular hydrogen (PubChem CID 142188922) has the molecular formula C8H19NO and a molecular weight of 145.25 g/mol. Its IUPAC name is 2-ethyl-N-methylpentanamide;molecular hydrogen.

Molecular Properties

Compound Name2-ethyl-N-methylpentanamide;molecular hydrogen
PubChem CID142188922
Molecular FormulaC8H19NO
Molecular Weight145.25 g/mol
Exact Mass145.15
IUPAC Name2-ethyl-N-methylpentanamide;molecular hydrogen
SMILESCCCC(CC)C(=O)NC.[H][H]
InChIInChI=1S/C8H17NO.H2/c1-4-6-7(5-2)8(10)9-3;/h7H,4-6H2,1-3H3,(H,9,10);1H
InChIKeyFHQIGLPEHAPPDU-UHFFFAOYSA-N
XLogP1.80
TPSA29.10 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500145.25
LogP ≤ 51.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-ethyl-N-methylpentanamide;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethyl-N-methylpentanamide;molecular hydrogen?
The IUPAC name of 2-ethyl-N-methylpentanamide;molecular hydrogen (CID 142188922) is 2-ethyl-N-methylpentanamide;molecular hydrogen.
What is the SMILES notation for 2-ethyl-N-methylpentanamide;molecular hydrogen?
The canonical SMILES for 2-ethyl-N-methylpentanamide;molecular hydrogen is CCCC(CC)C(=O)NC.[H][H].
What is the InChIKey of 2-ethyl-N-methylpentanamide;molecular hydrogen?
The InChIKey is FHQIGLPEHAPPDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO.H2/c1-4-6-7(5-2)8(10)9-3;/h7H,4-6H2,1-3H3,(H,9,10);1H.
What are the key properties of 2-ethyl-N-methylpentanamide;molecular hydrogen?
2-ethyl-N-methylpentanamide;molecular hydrogen has a molecular weight of 145.25 g/mol, XLogP of 1.80, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N-methylpentanamide;molecular hydrogen is sourced from PubChem (CID 142188922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).