C13H29NO — CID 144536587
2-ethyl-N,4,4-trimethylpentanamide;propane (PubChem CID 144536587) has the molecular formula C13H29NO and a molecular weight of 215.38 g/mol. Its IUPAC name is 2-ethyl-N,4,4-trimethylpentanamide;propane.
| Compound Name | 2-ethyl-N,4,4-trimethylpentanamide;propane |
|---|---|
| PubChem CID | 144536587 |
| Molecular Formula | C13H29NO |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.22 |
| IUPAC Name | 2-ethyl-N,4,4-trimethylpentanamide;propane |
| SMILES | CCC.CCC(CC(C)(C)C)C(=O)NC |
| InChI | InChI=1S/C10H21NO.C3H8/c1-6-8(9(12)11-5)7-10(2,3)4;1-3-2/h8H,6-7H2,1-5H3,(H,11,12);3H2,1-2H3 |
| InChIKey | YGDCWVCPMIZNAG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |