C19H38N2O2 — CID 166866622
2-ethyl-N-[[(2-ethyl-4,4-dimethylpentanoyl)amino]methyl]-4,4-dimethylpentanamide (PubChem CID 166866622) has the molecular formula C19H38N2O2 and a molecular weight of 326.53 g/mol. Its IUPAC name is 2-ethyl-N-[[(2-ethyl-4,4-dimethylpentanoyl)amino]methyl]-4,4-dimethylpentanamide.
| Compound Name | 2-ethyl-N-[[(2-ethyl-4,4-dimethylpentanoyl)amino]methyl]-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 166866622 |
| Molecular Formula | C19H38N2O2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.29 |
| IUPAC Name | 2-ethyl-N-[[(2-ethyl-4,4-dimethylpentanoyl)amino]methyl]-4,4-dimethylpentanamide |
| SMILES | CCC(CC(C)(C)C)C(=O)NCNC(=O)C(CC)CC(C)(C)C |
| InChI | InChI=1S/C19H38N2O2/c1-9-14(11-18(3,4)5)16(22)20-13-21-17(23)15(10-2)12-19(6,7)8/h14-15H,9-13H2,1-8H3,(H,20,22)(H,21,23) |
| InChIKey | AWFPSGFGVXLCOF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|