C15H23NO2 — CID 143326178
2-ethyl-N-(2-hydroxyphenyl)-4,4-dimethylpentanamide (PubChem CID 143326178) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 2-ethyl-N-(2-hydroxyphenyl)-4,4-dimethylpentanamide.
| Compound Name | 2-ethyl-N-(2-hydroxyphenyl)-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 143326178 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 2-ethyl-N-(2-hydroxyphenyl)-4,4-dimethylpentanamide |
| SMILES | CCC(CC(C)(C)C)C(=O)Nc1ccccc1O |
| InChI | InChI=1S/C15H23NO2/c1-5-11(10-15(2,3)4)14(18)16-12-8-6-7-9-13(12)17/h6-9,11,17H,5,10H2,1-4H3,(H,16,18) |
| InChIKey | MRTWMTHQLDSSCQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|