C13H24F3NO — CID 163592368
2-ethyl-4,4-dimethyl-N-(4,4,4-trifluorobutyl)pentanamide (PubChem CID 163592368) has the molecular formula C13H24F3NO and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-ethyl-4,4-dimethyl-N-(4,4,4-trifluorobutyl)pentanamide.
| Compound Name | 2-ethyl-4,4-dimethyl-N-(4,4,4-trifluorobutyl)pentanamide |
|---|---|
| PubChem CID | 163592368 |
| Molecular Formula | C13H24F3NO |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 2-ethyl-4,4-dimethyl-N-(4,4,4-trifluorobutyl)pentanamide |
| SMILES | CCC(CC(C)(C)C)C(=O)NCCCC(F)(F)F |
| InChI | InChI=1S/C13H24F3NO/c1-5-10(9-12(2,3)4)11(18)17-8-6-7-13(14,15)16/h10H,5-9H2,1-4H3,(H,17,18) |
| InChIKey | GQONWACDERLMHK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|