C11H20ClF2NO — CID 134548781
(4S)-4-chloro-2-ethyl-5,5-difluoro-4-methyl-N-propylpentanamide (PubChem CID 134548781) has the molecular formula C11H20ClF2NO and a molecular weight of 255.74 g/mol. Its IUPAC name is (4S)-4-chloro-2-ethyl-5,5-difluoro-4-methyl-N-propylpentanamide.
| Compound Name | (4S)-4-chloro-2-ethyl-5,5-difluoro-4-methyl-N-propylpentanamide |
|---|---|
| PubChem CID | 134548781 |
| Molecular Formula | C11H20ClF2NO |
| Molecular Weight | 255.74 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | (4S)-4-chloro-2-ethyl-5,5-difluoro-4-methyl-N-propylpentanamide |
| SMILES | CCCNC(=O)C(CC)C[C@](C)(Cl)C(F)F |
| InChI | InChI=1S/C11H20ClF2NO/c1-4-6-15-9(16)8(5-2)7-11(3,12)10(13)14/h8,10H,4-7H2,1-3H3,(H,15,16)/t8?,11-/m0/s1 |
| InChIKey | MFAWUSSPOUDUSI-LYNSQETBSA-N |
| XLogP | 3.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.74 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|