C19H38N2O4 — CID 157432754
2-ethylbutanoic acid;2-ethyl-N-[(2-ethylbutanoylamino)methyl]butanamide (PubChem CID 157432754) has the molecular formula C19H38N2O4 and a molecular weight of 358.52 g/mol. Its IUPAC name is 2-ethylbutanoic acid;2-ethyl-N-[(2-ethylbutanoylamino)methyl]butanamide.
| Compound Name | 2-ethylbutanoic acid;2-ethyl-N-[(2-ethylbutanoylamino)methyl]butanamide |
|---|---|
| PubChem CID | 157432754 |
| Molecular Formula | C19H38N2O4 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.28 |
| IUPAC Name | 2-ethylbutanoic acid;2-ethyl-N-[(2-ethylbutanoylamino)methyl]butanamide |
| SMILES | CCC(CC)C(=O)NCNC(=O)C(CC)CC.CCC(CC)C(=O)O |
| InChI | InChI=1S/C13H26N2O2.C6H12O2/c1-5-10(6-2)12(16)14-9-15-13(17)11(7-3)8-4;1-3-5(4-2)6(7)8/h10-11H,5-9H2,1-4H3,(H,14,16)(H,15,17);5H,3-4H2,1-2H3,(H,7,8) |
| InChIKey | BQSVOYQUBAKKLN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|