C23H42N4O6 — CID 122547910
5,8-dicarbamoyl-2-[3-methyl-4-[(2-methylbutanoylamino)methylamino]-4-oxobutyl]decanoic acid (PubChem CID 122547910) has the molecular formula C23H42N4O6 and a molecular weight of 470.61 g/mol. Its IUPAC name is 5,8-dicarbamoyl-2-[3-methyl-4-[(2-methylbutanoylamino)methylamino]-4-oxobutyl]decanoic acid.
| Compound Name | 5,8-dicarbamoyl-2-[3-methyl-4-[(2-methylbutanoylamino)methylamino]-4-oxobutyl]decanoic acid |
|---|---|
| PubChem CID | 122547910 |
| Molecular Formula | C23H42N4O6 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.31 |
| IUPAC Name | 5,8-dicarbamoyl-2-[3-methyl-4-[(2-methylbutanoylamino)methylamino]-4-oxobutyl]decanoic acid |
| SMILES | CCC(C)C(=O)NCNC(=O)C(C)CCC(CCC(CCC(CC)C(N)=O)C(N)=O)C(=O)O |
| InChI | InChI=1S/C23H42N4O6/c1-5-14(3)21(30)26-13-27-22(31)15(4)7-8-18(23(32)33)12-11-17(20(25)29)10-9-16(6-2)19(24)28/h14-18H,5-13H2,1-4H3,(H2,24,28)(H2,25,29)(H,26,30)(H,27,31)(H,32,33) |
| InChIKey | NPKAUFYXLBBKKN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 181.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|