C20H38N4O4 — CID 122547912
4-N,1-dimethyl-1-N-[(2-methylbutanoylamino)methyl]nonane-1,4,7-tricarboxamide (PubChem CID 122547912) has the molecular formula C20H38N4O4 and a molecular weight of 398.55 g/mol. Its IUPAC name is 4-N,1-dimethyl-1-N-[(2-methylbutanoylamino)methyl]nonane-1,4,7-tricarboxamide.
| Compound Name | 4-N,1-dimethyl-1-N-[(2-methylbutanoylamino)methyl]nonane-1,4,7-tricarboxamide |
|---|---|
| PubChem CID | 122547912 |
| Molecular Formula | C20H38N4O4 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | 4-N,1-dimethyl-1-N-[(2-methylbutanoylamino)methyl]nonane-1,4,7-tricarboxamide |
| SMILES | CCC(C)C(=O)NCNC(=O)C(C)CCC(CCC(CC)C(N)=O)C(=O)NC |
| InChI | InChI=1S/C20H38N4O4/c1-6-13(3)18(26)23-12-24-19(27)14(4)8-9-16(20(28)22-5)11-10-15(7-2)17(21)25/h13-16H,6-12H2,1-5H3,(H2,21,25)(H,22,28)(H,23,26)(H,24,27) |
| InChIKey | SVSYDWCFEVIOLB-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|