C9H19NO — CID 58247049
(2S)-N,2,4,4-tetramethylpentanamide (PubChem CID 58247049) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is (2S)-N,2,4,4-tetramethylpentanamide.
| Compound Name | (2S)-N,2,4,4-tetramethylpentanamide |
|---|---|
| PubChem CID | 58247049 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | (2S)-N,2,4,4-tetramethylpentanamide |
| SMILES | CNC(=O)[C@@H](C)CC(C)(C)C |
| InChI | InChI=1S/C9H19NO/c1-7(8(11)10-5)6-9(2,3)4/h7H,6H2,1-5H3,(H,10,11)/t7-/m0/s1 |
| InChIKey | LTIFIYVOXMPKLB-ZETCQYMHSA-N |
| XLogP | 1.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |