C5H11NO2 — CID 58246856
(2S)-3-hydroxy-N,2-dimethylpropanamide (PubChem CID 58246856) has the molecular formula C5H11NO2 and a molecular weight of 117.15 g/mol. Its IUPAC name is (2S)-3-hydroxy-N,2-dimethylpropanamide.
| Compound Name | (2S)-3-hydroxy-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 58246856 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | (2S)-3-hydroxy-N,2-dimethylpropanamide |
| SMILES | CNC(=O)[C@@H](C)CO |
| InChI | InChI=1S/C5H11NO2/c1-4(3-7)5(8)6-2/h4,7H,3H2,1-2H3,(H,6,8)/t4-/m0/s1 |
| InChIKey | GBCHGKJHHHFXHR-BYPYZUCNSA-N |
| XLogP | -0.64 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |