C6H12N2O3S — CID 88910601
S-methyl N-[[(2R)-3-hydroxy-2-methylpropanoyl]amino]carbamothioate (PubChem CID 88910601) has the molecular formula C6H12N2O3S and a molecular weight of 192.24 g/mol. Its IUPAC name is S-methyl N-[[(2R)-3-hydroxy-2-methylpropanoyl]amino]carbamothioate.
| Compound Name | S-methyl N-[[(2R)-3-hydroxy-2-methylpropanoyl]amino]carbamothioate |
|---|---|
| PubChem CID | 88910601 |
| Molecular Formula | C6H12N2O3S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | S-methyl N-[[(2R)-3-hydroxy-2-methylpropanoyl]amino]carbamothioate |
| SMILES | CSC(=O)NNC(=O)[C@H](C)CO |
| InChI | InChI=1S/C6H12N2O3S/c1-4(3-9)5(10)7-8-6(11)12-2/h4,9H,3H2,1-2H3,(H,7,10)(H,8,11)/t4-/m1/s1 |
| InChIKey | XZOVUYZZZVKTES-SCSAIBSYSA-N |
| XLogP | -0.28 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|