C12H26N2O3SSi — CID 88910598
S-methyl N-[[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpropanoyl]amino]carbamothioate (PubChem CID 88910598) has the molecular formula C12H26N2O3SSi and a molecular weight of 306.50 g/mol. Its IUPAC name is S-methyl N-[[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpropanoyl]amino]carbamothioate.
| Compound Name | S-methyl N-[[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpropanoyl]amino]carbamothioate |
|---|---|
| PubChem CID | 88910598 |
| Molecular Formula | C12H26N2O3SSi |
| Molecular Weight | 306.50 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | S-methyl N-[[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpropanoyl]amino]carbamothioate |
| SMILES | CSC(=O)NNC(=O)[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H26N2O3SSi/c1-9(10(15)13-14-11(16)18-5)8-17-19(6,7)12(2,3)4/h9H,8H2,1-7H3,(H,13,15)(H,14,16)/t9-/m1/s1 |
| InChIKey | ZAJCHKAHIAAGKE-SECBINFHSA-N |
| XLogP | 2.75 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|