C13H15IN2O3S — CID 88987982
butyl N-(7-iodo-4-methoxy-1,3-benzothiazol-2-yl)carbamate (PubChem CID 88987982) has the molecular formula C13H15IN2O3S and a molecular weight of 406.25 g/mol. Its IUPAC name is butyl N-(7-iodo-4-methoxy-1,3-benzothiazol-2-yl)carbamate.
| Compound Name | butyl N-(7-iodo-4-methoxy-1,3-benzothiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 88987982 |
| Molecular Formula | C13H15IN2O3S |
| Molecular Weight | 406.25 g/mol |
| Exact Mass | 405.98 |
| IUPAC Name | butyl N-(7-iodo-4-methoxy-1,3-benzothiazol-2-yl)carbamate |
| SMILES | CCCCOC(=O)Nc1nc2c(OC)ccc(I)c2s1 |
| InChI | InChI=1S/C13H15IN2O3S/c1-3-4-7-19-13(17)16-12-15-10-9(18-2)6-5-8(14)11(10)20-12/h5-6H,3-4,7H2,1-2H3,(H,15,16,17) |
| InChIKey | SOKLOPXFTMRWPV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.25 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|