C20H22N2O4S — CID 7192918
3-butoxy-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)benzamide (PubChem CID 7192918) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is 3-butoxy-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 3-butoxy-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 7192918 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 3-butoxy-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCCCOc1cccc(C(=O)Nc2nc3c(OC)ccc(OC)c3s2)c1 |
| InChI | InChI=1S/C20H22N2O4S/c1-4-5-11-26-14-8-6-7-13(12-14)19(23)22-20-21-17-15(24-2)9-10-16(25-3)18(17)27-20/h6-10,12H,4-5,11H2,1-3H3,(H,21,22,23) |
| InChIKey | LGVQOGWRNOHDNZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|