C25H31FN2O4 — CID 69345737
tert-butyl (3R,4R)-3-ethenyl-4-[3-(3-fluoro-6-methoxyquinolin-4-yl)-3-oxopropyl]piperidine-1-carboxylate (PubChem CID 69345737) has the molecular formula C25H31FN2O4 and a molecular weight of 442.53 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3-ethenyl-4-[3-(3-fluoro-6-methoxyquinolin-4-yl)-3-oxopropyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-3-ethenyl-4-[3-(3-fluoro-6-methoxyquinolin-4-yl)-3-oxopropyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 69345737 |
| Molecular Formula | C25H31FN2O4 |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | tert-butyl (3R,4R)-3-ethenyl-4-[3-(3-fluoro-6-methoxyquinolin-4-yl)-3-oxopropyl]piperidine-1-carboxylate |
| SMILES | C=C[C@H]1CN(C(=O)OC(C)(C)C)CC[C@H]1CCC(=O)c1c(F)cnc2ccc(OC)cc12 |
| InChI | InChI=1S/C25H31FN2O4/c1-6-16-15-28(24(30)32-25(2,3)4)12-11-17(16)7-10-22(29)23-19-13-18(31-5)8-9-21(19)27-14-20(23)26/h6,8-9,13-14,16-17H,1,7,10-12,15H2,2-5H3/t16-,17+/m0/s1 |
| InChIKey | OREGNAKZSUKOPB-DLBZAZTESA-N |
| XLogP | 5.40 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|