C20H27N3O3 — CID 175300918
tert-butyl 3-[(6-methoxyquinolin-3-yl)-methylamino]pyrrolidine-1-carboxylate (PubChem CID 175300918) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is tert-butyl 3-[(6-methoxyquinolin-3-yl)-methylamino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(6-methoxyquinolin-3-yl)-methylamino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 175300918 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | tert-butyl 3-[(6-methoxyquinolin-3-yl)-methylamino]pyrrolidine-1-carboxylate |
| SMILES | COc1ccc2ncc(N(C)C3CCN(C(=O)OC(C)(C)C)C3)cc2c1 |
| InChI | InChI=1S/C20H27N3O3/c1-20(2,3)26-19(24)23-9-8-15(13-23)22(4)16-10-14-11-17(25-5)6-7-18(14)21-12-16/h6-7,10-12,15H,8-9,13H2,1-5H3 |
| InChIKey | IOKKRBRPURATBK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |