C18H28N2O5 — CID 146278733
tert-butyl (3S)-3-[(2,4-dimethoxyphenyl)methyl-hydroxyamino]pyrrolidine-1-carboxylate (PubChem CID 146278733) has the molecular formula C18H28N2O5 and a molecular weight of 352.43 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(2,4-dimethoxyphenyl)methyl-hydroxyamino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(2,4-dimethoxyphenyl)methyl-hydroxyamino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 146278733 |
| Molecular Formula | C18H28N2O5 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | tert-butyl (3S)-3-[(2,4-dimethoxyphenyl)methyl-hydroxyamino]pyrrolidine-1-carboxylate |
| SMILES | COc1ccc(CN(O)[C@H]2CCN(C(=O)OC(C)(C)C)C2)c(OC)c1 |
| InChI | InChI=1S/C18H28N2O5/c1-18(2,3)25-17(21)19-9-8-14(12-19)20(22)11-13-6-7-15(23-4)10-16(13)24-5/h6-7,10,14,22H,8-9,11-12H2,1-5H3/t14-/m0/s1 |
| InChIKey | XQLBXUCMXRBNBW-AWEZNQCLSA-N |
| XLogP | 2.90 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|