C21H31N3O5 — CID 170567046
tert-butyl 2-[(2,4-dimethoxyphenyl)methyl]-4-oxo-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carboxylate (PubChem CID 170567046) has the molecular formula C21H31N3O5 and a molecular weight of 405.50 g/mol. Its IUPAC name is tert-butyl 2-[(2,4-dimethoxyphenyl)methyl]-4-oxo-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carboxylate.
| Compound Name | tert-butyl 2-[(2,4-dimethoxyphenyl)methyl]-4-oxo-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carboxylate |
|---|---|
| PubChem CID | 170567046 |
| Molecular Formula | C21H31N3O5 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | tert-butyl 2-[(2,4-dimethoxyphenyl)methyl]-4-oxo-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carboxylate |
| SMILES | COc1ccc(CN2CC(=O)N3CCN(C(=O)OC(C)(C)C)CC3C2)c(OC)c1 |
| InChI | InChI=1S/C21H31N3O5/c1-21(2,3)29-20(26)23-8-9-24-16(13-23)12-22(14-19(24)25)11-15-6-7-17(27-4)10-18(15)28-5/h6-7,10,16H,8-9,11-14H2,1-5H3 |
| InChIKey | IJURAIHIIIELGM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |