C26H39N3O5 — CID 143876016
tert-butyl 4-[2-[(3-formyl-6-methoxyquinolin-4-yl)amino]ethyl]piperidine-1-carboxylate;methoxyethane (PubChem CID 143876016) has the molecular formula C26H39N3O5 and a molecular weight of 473.61 g/mol. Its IUPAC name is tert-butyl 4-[2-[(3-formyl-6-methoxyquinolin-4-yl)amino]ethyl]piperidine-1-carboxylate;methoxyethane.
| Compound Name | tert-butyl 4-[2-[(3-formyl-6-methoxyquinolin-4-yl)amino]ethyl]piperidine-1-carboxylate;methoxyethane |
|---|---|
| PubChem CID | 143876016 |
| Molecular Formula | C26H39N3O5 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | tert-butyl 4-[2-[(3-formyl-6-methoxyquinolin-4-yl)amino]ethyl]piperidine-1-carboxylate;methoxyethane |
| SMILES | CCOC.COc1ccc2ncc(C=O)c(NCCC3CCN(C(=O)OC(C)(C)C)CC3)c2c1 |
| InChI | InChI=1S/C23H31N3O4.C3H8O/c1-23(2,3)30-22(28)26-11-8-16(9-12-26)7-10-24-21-17(15-27)14-25-20-6-5-18(29-4)13-19(20)21;1-3-4-2/h5-6,13-16H,7-12H2,1-4H3,(H,24,25);3H2,1-2H3 |
| InChIKey | NZCNDQJKVICEEC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|